C27H27N3O2 — CID 141234209
8-(2,2-diphenylacetyl)-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one (PubChem CID 141234209) has the molecular formula C27H27N3O2 and a molecular weight of 425.53 g/mol. Its IUPAC name is 8-(2,2-diphenylacetyl)-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one.
| Compound Name | 8-(2,2-diphenylacetyl)-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 141234209 |
| Molecular Formula | C27H27N3O2 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 8-(2,2-diphenylacetyl)-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
| SMILES | O=C(C(c1ccccc1)c1ccccc1)N1CCC2(CC1)C(=O)NCN2c1ccccc1 |
| InChI | InChI=1S/C27H27N3O2/c31-25(24(21-10-4-1-5-11-21)22-12-6-2-7-13-22)29-18-16-27(17-19-29)26(32)28-20-30(27)23-14-8-3-9-15-23/h1-15,24H,16-20H2,(H,28,32) |
| InChIKey | QKSNOCSHGUUNHU-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |