C22H40O7 — CID 141234966
[5,7-dihydroxy-4,4,6,6,8-pentamethyl-3-(2-methylpropanoyloxy)-2-oxononan-3-yl] 2-methylpropanoate (PubChem CID 141234966) has the molecular formula C22H40O7 and a molecular weight of 416.56 g/mol. Its IUPAC name is [5,7-dihydroxy-4,4,6,6,8-pentamethyl-3-(2-methylpropanoyloxy)-2-oxononan-3-yl] 2-methylpropanoate.
| Compound Name | [5,7-dihydroxy-4,4,6,6,8-pentamethyl-3-(2-methylpropanoyloxy)-2-oxononan-3-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 141234966 |
| Molecular Formula | C22H40O7 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.28 |
| IUPAC Name | [5,7-dihydroxy-4,4,6,6,8-pentamethyl-3-(2-methylpropanoyloxy)-2-oxononan-3-yl] 2-methylpropanoate |
| SMILES | CC(=O)C(OC(=O)C(C)C)(OC(=O)C(C)C)C(C)(C)C(O)C(C)(C)C(O)C(C)C |
| InChI | InChI=1S/C22H40O7/c1-12(2)16(24)20(8,9)19(27)21(10,11)22(15(7)23,28-17(25)13(3)4)29-18(26)14(5)6/h12-14,16,19,24,27H,1-11H3 |
| InChIKey | SWBHNVOEPPWODP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|