C26H25Cl2FN4O2 — CID 141235103
5-[6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]spiro[1,2-dihydroindole-3,4'-piperidine]-1'-carbaldehyde (PubChem CID 141235103) has the molecular formula C26H25Cl2FN4O2 and a molecular weight of 515.42 g/mol. Its IUPAC name is 5-[6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]spiro[1,2-dihydroindole-3,4'-piperidine]-1'-carbaldehyde.
| Compound Name | 5-[6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]spiro[1,2-dihydroindole-3,4'-piperidine]-1'-carbaldehyde |
|---|---|
| PubChem CID | 141235103 |
| Molecular Formula | C26H25Cl2FN4O2 |
| Molecular Weight | 515.42 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | 5-[6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]spiro[1,2-dihydroindole-3,4'-piperidine]-1'-carbaldehyde |
| SMILES | C[C@@H](Oc1cc(-c2ccc3c(c2)C2(CCN(C=O)CC2)CN3)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C26H25Cl2FN4O2/c1-15(23-19(27)3-4-20(29)24(23)28)35-22-11-17(12-31-25(22)30)16-2-5-21-18(10-16)26(13-32-21)6-8-33(14-34)9-7-26/h2-5,10-12,14-15,32H,6-9,13H2,1H3,(H2,30,31)/t15-/m1/s1 |
| InChIKey | JDQIFLVPNBDSAZ-OAHLLOKOSA-N |
| XLogP | 5.83 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.42 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|