C16H12F3NO6S — CID 141235202
(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl) [4-(trifluoromethyl)phenyl] sulfate (PubChem CID 141235202) has the molecular formula C16H12F3NO6S and a molecular weight of 403.33 g/mol. Its IUPAC name is (3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl) [4-(trifluoromethyl)phenyl] sulfate.
| Compound Name | (3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl) [4-(trifluoromethyl)phenyl] sulfate |
|---|---|
| PubChem CID | 141235202 |
| Molecular Formula | C16H12F3NO6S |
| Molecular Weight | 403.33 g/mol |
| Exact Mass | 403.03 |
| IUPAC Name | (3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl) [4-(trifluoromethyl)phenyl] sulfate |
| SMILES | O=C1C2C3C=CC(C3)C2C(=O)N1OS(=O)(=O)Oc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H12F3NO6S/c17-16(18,19)10-3-5-11(6-4-10)25-27(23,24)26-20-14(21)12-8-1-2-9(7-8)13(12)15(20)22/h1-6,8-9,12-13H,7H2 |
| InChIKey | PZYGLHRXNHXBTH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.33 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|