C12H11Cl2N5O6 — CID 141235702
(3E,5Z)-3,5-diamino-2-(3,4-dichlorophenyl)-9,10-dihydroxy-1,7-dioxa-2,4,6-triazacycloundeca-3,5-diene-8,11-dione (PubChem CID 141235702) has the molecular formula C12H11Cl2N5O6 and a molecular weight of 392.16 g/mol. Its IUPAC name is (3E,5Z)-3,5-diamino-2-(3,4-dichlorophenyl)-9,10-dihydroxy-1,7-dioxa-2,4,6-triazacycloundeca-3,5-diene-8,11-dione.
| Compound Name | (3E,5Z)-3,5-diamino-2-(3,4-dichlorophenyl)-9,10-dihydroxy-1,7-dioxa-2,4,6-triazacycloundeca-3,5-diene-8,11-dione |
|---|---|
| PubChem CID | 141235702 |
| Molecular Formula | C12H11Cl2N5O6 |
| Molecular Weight | 392.16 g/mol |
| Exact Mass | 391.01 |
| IUPAC Name | (3E,5Z)-3,5-diamino-2-(3,4-dichlorophenyl)-9,10-dihydroxy-1,7-dioxa-2,4,6-triazacycloundeca-3,5-diene-8,11-dione |
| SMILES | NC1=N/OC(=O)C(O)C(O)C(=O)ON(c2ccc(Cl)c(Cl)c2)/C(N)=N\1 |
| InChI | InChI=1S/C12H11Cl2N5O6/c13-5-2-1-4(3-6(5)14)19-12(16)17-11(15)18-24-9(22)7(20)8(21)10(23)25-19/h1-3,7-8,20-21H,(H4,15,16,17,18) |
| InChIKey | WRNHWPLDZWWKKG-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 173.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.16 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|