C20H17F5N2O2 — CID 141235758
methyl (2R,3R)-2-(4-methylphenyl)-4-(1,1,2,2,2-pentafluoroethyl)-2,3-dihydro-1H-1,5-benzodiazepine-3-carboxylate (PubChem CID 141235758) has the molecular formula C20H17F5N2O2 and a molecular weight of 412.36 g/mol. Its IUPAC name is methyl (2R,3R)-2-(4-methylphenyl)-4-(1,1,2,2,2-pentafluoroethyl)-2,3-dihydro-1H-1,5-benzodiazepine-3-carboxylate.
| Compound Name | methyl (2R,3R)-2-(4-methylphenyl)-4-(1,1,2,2,2-pentafluoroethyl)-2,3-dihydro-1H-1,5-benzodiazepine-3-carboxylate |
|---|---|
| PubChem CID | 141235758 |
| Molecular Formula | C20H17F5N2O2 |
| Molecular Weight | 412.36 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | methyl (2R,3R)-2-(4-methylphenyl)-4-(1,1,2,2,2-pentafluoroethyl)-2,3-dihydro-1H-1,5-benzodiazepine-3-carboxylate |
| SMILES | COC(=O)[C@H]1C(C(F)(F)C(F)(F)F)=Nc2ccccc2N[C@H]1c1ccc(C)cc1 |
| InChI | InChI=1S/C20H17F5N2O2/c1-11-7-9-12(10-8-11)16-15(18(28)29-2)17(19(21,22)20(23,24)25)27-14-6-4-3-5-13(14)26-16/h3-10,15-16,26H,1-2H3/t15-,16+/m1/s1 |
| InChIKey | KKACVAYWYBANGX-CVEARBPZSA-N |
| XLogP | 5.22 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.36 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|