About 1-chloro-2,3-dimethoxy-4,5,6-trimethylbenzene
1-chloro-2,3-dimethoxy-4,5,6-trimethylbenzene (PubChem CID 141236013) has the molecular formula C11H15ClO2
and a molecular weight of 214.69 g/mol. Its IUPAC name is 1-chloro-2,3-dimethoxy-4,5,6-trimethylbenzene.
Molecular Properties
| Compound Name | 1-chloro-2,3-dimethoxy-4,5,6-trimethylbenzene |
| PubChem CID | 141236013 |
| Molecular Formula | C11H15ClO2 |
| Molecular Weight | 214.69 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 1-chloro-2,3-dimethoxy-4,5,6-trimethylbenzene |
| SMILES | COc1c(C)c(C)c(C)c(Cl)c1OC |
| InChI | InChI=1S/C11H15ClO2/c1-6-7(2)9(12)11(14-5)10(13-4)8(6)3/h1-5H3 |
| InChIKey | LKKLJXAANLDIRY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.69 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-chloro-2,3-dimethoxy-4,5,6-trimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2,3-dimethoxy-4,5,6-trimethylbenzene?
The IUPAC name of 1-chloro-2,3-dimethoxy-4,5,6-trimethylbenzene (CID 141236013) is 1-chloro-2,3-dimethoxy-4,5,6-trimethylbenzene.
What is the SMILES notation for 1-chloro-2,3-dimethoxy-4,5,6-trimethylbenzene?
The canonical SMILES for 1-chloro-2,3-dimethoxy-4,5,6-trimethylbenzene is COc1c(C)c(C)c(C)c(Cl)c1OC.
What is the InChIKey of 1-chloro-2,3-dimethoxy-4,5,6-trimethylbenzene?
The InChIKey is LKKLJXAANLDIRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15ClO2/c1-6-7(2)9(12)11(14-5)10(13-4)8(6)3/h1-5H3.
What are the key properties of 1-chloro-2,3-dimethoxy-4,5,6-trimethylbenzene?
1-chloro-2,3-dimethoxy-4,5,6-trimethylbenzene has a molecular weight of 214.69 g/mol, XLogP of 3.28, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2,3-dimethoxy-4,5,6-trimethylbenzene is sourced from PubChem (CID 141236013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).