C10H6F6N2S — CID 141237141
5-(1,1,1,2,3,3-hexafluoropropan-2-yl)-2-pyrrol-1-yl-1,3-thiazole (PubChem CID 141237141) has the molecular formula C10H6F6N2S and a molecular weight of 300.23 g/mol. Its IUPAC name is 5-(1,1,1,2,3,3-hexafluoropropan-2-yl)-2-pyrrol-1-yl-1,3-thiazole.
| Compound Name | 5-(1,1,1,2,3,3-hexafluoropropan-2-yl)-2-pyrrol-1-yl-1,3-thiazole |
|---|---|
| PubChem CID | 141237141 |
| Molecular Formula | C10H6F6N2S |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | 5-(1,1,1,2,3,3-hexafluoropropan-2-yl)-2-pyrrol-1-yl-1,3-thiazole |
| SMILES | FC(F)C(F)(c1cnc(-n2cccc2)s1)C(F)(F)F |
| InChI | InChI=1S/C10H6F6N2S/c11-7(12)9(13,10(14,15)16)6-5-17-8(19-6)18-3-1-2-4-18/h1-5,7H |
| InChIKey | RCKLYDQHECUOAE-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |