C12H16O4 — CID 141237646
4,5,6-trimethoxy-2,3,4,5-tetrahydroinden-1-one (PubChem CID 141237646) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is 4,5,6-trimethoxy-2,3,4,5-tetrahydroinden-1-one.
| Compound Name | 4,5,6-trimethoxy-2,3,4,5-tetrahydroinden-1-one |
|---|---|
| PubChem CID | 141237646 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 4,5,6-trimethoxy-2,3,4,5-tetrahydroinden-1-one |
| SMILES | COC1=CC2=C(CCC2=O)C(OC)C1OC |
| InChI | InChI=1S/C12H16O4/c1-14-10-6-8-7(4-5-9(8)13)11(15-2)12(10)16-3/h6,11-12H,4-5H2,1-3H3 |
| InChIKey | DDXSUQAVGZOXIL-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |