About 2-[[2-(2-methyl-1,3-dioxol-2-yl)-1,3-thiazol-5-yl]methyl]triazol-4-amine
2-[[2-(2-methyl-1,3-dioxol-2-yl)-1,3-thiazol-5-yl]methyl]triazol-4-amine (PubChem CID 141238253) has the molecular formula C10H11N5O2S
and a molecular weight of 265.30 g/mol. Its IUPAC name is 2-[[2-(2-methyl-1,3-dioxol-2-yl)-1,3-thiazol-5-yl]methyl]triazol-4-amine.
Molecular Properties
| Compound Name | 2-[[2-(2-methyl-1,3-dioxol-2-yl)-1,3-thiazol-5-yl]methyl]triazol-4-amine |
| PubChem CID | 141238253 |
| Molecular Formula | C10H11N5O2S |
| Molecular Weight | 265.30 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | 2-[[2-(2-methyl-1,3-dioxol-2-yl)-1,3-thiazol-5-yl]methyl]triazol-4-amine |
| SMILES | CC1(c2ncc(Cn3ncc(N)n3)s2)OC=CO1 |
| InChI | InChI=1S/C10H11N5O2S/c1-10(16-2-3-17-10)9-12-4-7(18-9)6-15-13-5-8(11)14-15/h2-5H,6H2,1H3,(H2,11,14) |
| InChIKey | IRGPXZBXLNPDIX-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.30 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-[[2-(2-methyl-1,3-dioxol-2-yl)-1,3-thiazol-5-yl]methyl]triazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(2-methyl-1,3-dioxol-2-yl)-1,3-thiazol-5-yl]methyl]triazol-4-amine?
The IUPAC name of 2-[[2-(2-methyl-1,3-dioxol-2-yl)-1,3-thiazol-5-yl]methyl]triazol-4-amine (CID 141238253) is 2-[[2-(2-methyl-1,3-dioxol-2-yl)-1,3-thiazol-5-yl]methyl]triazol-4-amine.
What is the SMILES notation for 2-[[2-(2-methyl-1,3-dioxol-2-yl)-1,3-thiazol-5-yl]methyl]triazol-4-amine?
The canonical SMILES for 2-[[2-(2-methyl-1,3-dioxol-2-yl)-1,3-thiazol-5-yl]methyl]triazol-4-amine is CC1(c2ncc(Cn3ncc(N)n3)s2)OC=CO1.
What is the InChIKey of 2-[[2-(2-methyl-1,3-dioxol-2-yl)-1,3-thiazol-5-yl]methyl]triazol-4-amine?
The InChIKey is IRGPXZBXLNPDIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N5O2S/c1-10(16-2-3-17-10)9-12-4-7(18-9)6-15-13-5-8(11)14-15/h2-5H,6H2,1H3,(H2,11,14).
What are the key properties of 2-[[2-(2-methyl-1,3-dioxol-2-yl)-1,3-thiazol-5-yl]methyl]triazol-4-amine?
2-[[2-(2-methyl-1,3-dioxol-2-yl)-1,3-thiazol-5-yl]methyl]triazol-4-amine has a molecular weight of 265.30 g/mol, XLogP of 1.06, 3 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(2-methyl-1,3-dioxol-2-yl)-1,3-thiazol-5-yl]methyl]triazol-4-amine is sourced from PubChem (CID 141238253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).