About 5-bromo-2H-1,3-thiazole-3-carboxylic acid
5-bromo-2H-1,3-thiazole-3-carboxylic acid (PubChem CID 141238500) has the molecular formula C4H4BrNO2S
and a molecular weight of 210.05 g/mol. Its IUPAC name is 5-bromo-2H-1,3-thiazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-bromo-2H-1,3-thiazole-3-carboxylic acid |
| PubChem CID | 141238500 |
| Molecular Formula | C4H4BrNO2S |
| Molecular Weight | 210.05 g/mol |
| Exact Mass | 208.91 |
| IUPAC Name | 5-bromo-2H-1,3-thiazole-3-carboxylic acid |
| SMILES | O=C(O)N1C=C(Br)SC1 |
| InChI | InChI=1S/C4H4BrNO2S/c5-3-1-6(2-9-3)4(7)8/h1H,2H2,(H,7,8) |
| InChIKey | XQOVSIQGGMRCQF-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.05 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-2H-1,3-thiazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2H-1,3-thiazole-3-carboxylic acid?
The IUPAC name of 5-bromo-2H-1,3-thiazole-3-carboxylic acid (CID 141238500) is 5-bromo-2H-1,3-thiazole-3-carboxylic acid.
What is the SMILES notation for 5-bromo-2H-1,3-thiazole-3-carboxylic acid?
The canonical SMILES for 5-bromo-2H-1,3-thiazole-3-carboxylic acid is O=C(O)N1C=C(Br)SC1.
What is the InChIKey of 5-bromo-2H-1,3-thiazole-3-carboxylic acid?
The InChIKey is XQOVSIQGGMRCQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4BrNO2S/c5-3-1-6(2-9-3)4(7)8/h1H,2H2,(H,7,8).
What are the key properties of 5-bromo-2H-1,3-thiazole-3-carboxylic acid?
5-bromo-2H-1,3-thiazole-3-carboxylic acid has a molecular weight of 210.05 g/mol, XLogP of 1.86, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2H-1,3-thiazole-3-carboxylic acid is sourced from PubChem (CID 141238500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).