C13H29N7O5 — CID 141238675
2-[2-[2-(1-amino-1-hydroxyiminopropan-2-yl)oxyethyl-(3-amino-3-hydroxyiminopropyl)amino]ethoxy]-N'-hydroxypropanimidamide (PubChem CID 141238675) has the molecular formula C13H29N7O5 and a molecular weight of 363.42 g/mol. Its IUPAC name is 2-[2-[2-(1-amino-1-hydroxyiminopropan-2-yl)oxyethyl-(3-amino-3-hydroxyiminopropyl)amino]ethoxy]-N'-hydroxypropanimidamide.
| Compound Name | 2-[2-[2-(1-amino-1-hydroxyiminopropan-2-yl)oxyethyl-(3-amino-3-hydroxyiminopropyl)amino]ethoxy]-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 141238675 |
| Molecular Formula | C13H29N7O5 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | 2-[2-[2-(1-amino-1-hydroxyiminopropan-2-yl)oxyethyl-(3-amino-3-hydroxyiminopropyl)amino]ethoxy]-N'-hydroxypropanimidamide |
| SMILES | CC(OCCN(CCOC(C)C(N)=NO)CCC(N)=NO)C(N)=NO |
| InChI | InChI=1S/C13H29N7O5/c1-9(12(15)18-22)24-7-5-20(4-3-11(14)17-21)6-8-25-10(2)13(16)19-23/h9-10,21-23H,3-8H2,1-2H3,(H2,14,17)(H2,15,18)(H2,16,19) |
| InChIKey | PVJYSKOOQDAERQ-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 197.53 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|