About 2-fluoro-6H-thiochromeno[4,3-b]quinolin-11-ol
2-fluoro-6H-thiochromeno[4,3-b]quinolin-11-ol (PubChem CID 141238824) has the molecular formula C16H10FNOS
and a molecular weight of 283.33 g/mol. Its IUPAC name is 2-fluoro-6H-thiochromeno[4,3-b]quinolin-11-ol.
Molecular Properties
| Compound Name | 2-fluoro-6H-thiochromeno[4,3-b]quinolin-11-ol |
| PubChem CID | 141238824 |
| Molecular Formula | C16H10FNOS |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 2-fluoro-6H-thiochromeno[4,3-b]quinolin-11-ol |
| SMILES | Oc1cccc2cc3c(nc12)-c1cc(F)ccc1SC3 |
| InChI | InChI=1S/C16H10FNOS/c17-11-4-5-14-12(7-11)15-10(8-20-14)6-9-2-1-3-13(19)16(9)18-15/h1-7,19H,8H2 |
| InChIKey | YBLCETSYTKOLJG-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-fluoro-6H-thiochromeno[4,3-b]quinolin-11-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-6H-thiochromeno[4,3-b]quinolin-11-ol?
The IUPAC name of 2-fluoro-6H-thiochromeno[4,3-b]quinolin-11-ol (CID 141238824) is 2-fluoro-6H-thiochromeno[4,3-b]quinolin-11-ol.
What is the SMILES notation for 2-fluoro-6H-thiochromeno[4,3-b]quinolin-11-ol?
The canonical SMILES for 2-fluoro-6H-thiochromeno[4,3-b]quinolin-11-ol is Oc1cccc2cc3c(nc12)-c1cc(F)ccc1SC3.
What is the InChIKey of 2-fluoro-6H-thiochromeno[4,3-b]quinolin-11-ol?
The InChIKey is YBLCETSYTKOLJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10FNOS/c17-11-4-5-14-12(7-11)15-10(8-20-14)6-9-2-1-3-13(19)16(9)18-15/h1-7,19H,8H2.
What are the key properties of 2-fluoro-6H-thiochromeno[4,3-b]quinolin-11-ol?
2-fluoro-6H-thiochromeno[4,3-b]quinolin-11-ol has a molecular weight of 283.33 g/mol, XLogP of 4.35, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-6H-thiochromeno[4,3-b]quinolin-11-ol is sourced from PubChem (CID 141238824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).