C15H21BrN4O2 — CID 141239241
2-[[6-bromo-7,8-dimethyl-2-(2-methylpropyl)imidazo[1,2-a]pyridin-3-yl]amino]-N-hydroxyacetamide (PubChem CID 141239241) has the molecular formula C15H21BrN4O2 and a molecular weight of 369.26 g/mol. Its IUPAC name is 2-[[6-bromo-7,8-dimethyl-2-(2-methylpropyl)imidazo[1,2-a]pyridin-3-yl]amino]-N-hydroxyacetamide.
| Compound Name | 2-[[6-bromo-7,8-dimethyl-2-(2-methylpropyl)imidazo[1,2-a]pyridin-3-yl]amino]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 141239241 |
| Molecular Formula | C15H21BrN4O2 |
| Molecular Weight | 369.26 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 2-[[6-bromo-7,8-dimethyl-2-(2-methylpropyl)imidazo[1,2-a]pyridin-3-yl]amino]-N-hydroxyacetamide |
| SMILES | Cc1c(Br)cn2c(NCC(=O)NO)c(CC(C)C)nc2c1C |
| InChI | InChI=1S/C15H21BrN4O2/c1-8(2)5-12-15(17-6-13(21)19-22)20-7-11(16)9(3)10(4)14(20)18-12/h7-8,17,22H,5-6H2,1-4H3,(H,19,21) |
| InChIKey | YIQKCPGQSBMATL-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.26 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|