C17H18ClF3N4O2 — CID 141239311
2-[[8-chloro-2-hept-1-ynyl-6-(trifluoromethyl)imidazo[1,2-a]pyridin-3-yl]amino]-N-hydroxyacetamide (PubChem CID 141239311) has the molecular formula C17H18ClF3N4O2 and a molecular weight of 402.80 g/mol. Its IUPAC name is 2-[[8-chloro-2-hept-1-ynyl-6-(trifluoromethyl)imidazo[1,2-a]pyridin-3-yl]amino]-N-hydroxyacetamide.
| Compound Name | 2-[[8-chloro-2-hept-1-ynyl-6-(trifluoromethyl)imidazo[1,2-a]pyridin-3-yl]amino]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 141239311 |
| Molecular Formula | C17H18ClF3N4O2 |
| Molecular Weight | 402.80 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 2-[[8-chloro-2-hept-1-ynyl-6-(trifluoromethyl)imidazo[1,2-a]pyridin-3-yl]amino]-N-hydroxyacetamide |
| SMILES | CCCCCC#Cc1nc2c(Cl)cc(C(F)(F)F)cn2c1NCC(=O)NO |
| InChI | InChI=1S/C17H18ClF3N4O2/c1-2-3-4-5-6-7-13-16(22-9-14(26)24-27)25-10-11(17(19,20)21)8-12(18)15(25)23-13/h8,10,22,27H,2-5,9H2,1H3,(H,24,26) |
| InChIKey | GLDMUGMPGYDUDK-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.80 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|