C17H26N4O2 — CID 141239414
2-[[2-(2,2-dimethylpropyl)-5-propylimidazo[1,2-a]pyridin-3-yl]amino]-N-hydroxyacetamide (PubChem CID 141239414) has the molecular formula C17H26N4O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is 2-[[2-(2,2-dimethylpropyl)-5-propylimidazo[1,2-a]pyridin-3-yl]amino]-N-hydroxyacetamide.
| Compound Name | 2-[[2-(2,2-dimethylpropyl)-5-propylimidazo[1,2-a]pyridin-3-yl]amino]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 141239414 |
| Molecular Formula | C17H26N4O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | 2-[[2-(2,2-dimethylpropyl)-5-propylimidazo[1,2-a]pyridin-3-yl]amino]-N-hydroxyacetamide |
| SMILES | CCCc1cccc2nc(CC(C)(C)C)c(NCC(=O)NO)n12 |
| InChI | InChI=1S/C17H26N4O2/c1-5-7-12-8-6-9-14-19-13(10-17(2,3)4)16(21(12)14)18-11-15(22)20-23/h6,8-9,18,23H,5,7,10-11H2,1-4H3,(H,20,22) |
| InChIKey | FLHLINZHACQBHH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|