C14H16Br2N4O4 — CID 141239433
3-[6,8-dibromo-3-[[2-(hydroxyamino)-2-oxoethyl]amino]-5,7-dimethylimidazo[1,2-a]pyridin-2-yl]propanoic acid (PubChem CID 141239433) has the molecular formula C14H16Br2N4O4 and a molecular weight of 464.11 g/mol. Its IUPAC name is 3-[6,8-dibromo-3-[[2-(hydroxyamino)-2-oxoethyl]amino]-5,7-dimethylimidazo[1,2-a]pyridin-2-yl]propanoic acid.
| Compound Name | 3-[6,8-dibromo-3-[[2-(hydroxyamino)-2-oxoethyl]amino]-5,7-dimethylimidazo[1,2-a]pyridin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 141239433 |
| Molecular Formula | C14H16Br2N4O4 |
| Molecular Weight | 464.11 g/mol |
| Exact Mass | 461.95 |
| IUPAC Name | 3-[6,8-dibromo-3-[[2-(hydroxyamino)-2-oxoethyl]amino]-5,7-dimethylimidazo[1,2-a]pyridin-2-yl]propanoic acid |
| SMILES | Cc1c(Br)c(C)n2c(NCC(=O)NO)c(CCC(=O)O)nc2c1Br |
| InChI | InChI=1S/C14H16Br2N4O4/c1-6-11(15)7(2)20-13(17-5-9(21)19-24)8(3-4-10(22)23)18-14(20)12(6)16/h17,24H,3-5H2,1-2H3,(H,19,21)(H,22,23) |
| InChIKey | LXHVKNCZKDECSN-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 115.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.11 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|