C6HBF8Li2O2 — CID 141240238
dilithium;(1,2,3,4,5,5,6,6-octafluorocyclohex-2-en-1-yl)-dioxidoborane (PubChem CID 141240238) has the molecular formula C6HBF8Li2O2 and a molecular weight of 281.75 g/mol. Its IUPAC name is dilithium;(1,2,3,4,5,5,6,6-octafluorocyclohex-2-en-1-yl)-dioxidoborane.
| Compound Name | dilithium;(1,2,3,4,5,5,6,6-octafluorocyclohex-2-en-1-yl)-dioxidoborane |
|---|---|
| PubChem CID | 141240238 |
| Molecular Formula | C6HBF8Li2O2 |
| Molecular Weight | 281.75 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | dilithium;(1,2,3,4,5,5,6,6-octafluorocyclohex-2-en-1-yl)-dioxidoborane |
| SMILES | [Li+].[Li+].[O-]B([O-])C1(F)C(F)=C(F)C(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C6HBF8O2.2Li/c8-1-2(9)4(11,7(16)17)6(14,15)5(12,13)3(1)10;;/h3H;;/q-2;2*+1 |
| InChIKey | VPTGAJKYRKLIKP-UHFFFAOYSA-N |
| XLogP | -5.78 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.75 |
| LogP ≤ 5 | -5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|