C14H19BrN4O2 — CID 141240860
2-[(6-bromo-8-methyl-3-propylimidazo[1,2-a]pyridin-2-yl)amino]-N-hydroxypropanamide (PubChem CID 141240860) has the molecular formula C14H19BrN4O2 and a molecular weight of 355.24 g/mol. Its IUPAC name is 2-[(6-bromo-8-methyl-3-propylimidazo[1,2-a]pyridin-2-yl)amino]-N-hydroxypropanamide.
| Compound Name | 2-[(6-bromo-8-methyl-3-propylimidazo[1,2-a]pyridin-2-yl)amino]-N-hydroxypropanamide |
|---|---|
| PubChem CID | 141240860 |
| Molecular Formula | C14H19BrN4O2 |
| Molecular Weight | 355.24 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 2-[(6-bromo-8-methyl-3-propylimidazo[1,2-a]pyridin-2-yl)amino]-N-hydroxypropanamide |
| SMILES | CCCc1c(NC(C)C(=O)NO)nc2c(C)cc(Br)cn12 |
| InChI | InChI=1S/C14H19BrN4O2/c1-4-5-11-12(16-9(3)14(20)18-21)17-13-8(2)6-10(15)7-19(11)13/h6-7,9,16,21H,4-5H2,1-3H3,(H,18,20) |
| InChIKey | YLFLOFHTGRKUOB-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.24 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|