C14H20BrN5O2 — CID 141241060
2-[[8-amino-6-bromo-3-(2,2-dimethylpropyl)imidazo[1,2-a]pyridin-2-yl]amino]-N-hydroxyacetamide (PubChem CID 141241060) has the molecular formula C14H20BrN5O2 and a molecular weight of 370.25 g/mol. Its IUPAC name is 2-[[8-amino-6-bromo-3-(2,2-dimethylpropyl)imidazo[1,2-a]pyridin-2-yl]amino]-N-hydroxyacetamide.
| Compound Name | 2-[[8-amino-6-bromo-3-(2,2-dimethylpropyl)imidazo[1,2-a]pyridin-2-yl]amino]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 141241060 |
| Molecular Formula | C14H20BrN5O2 |
| Molecular Weight | 370.25 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | 2-[[8-amino-6-bromo-3-(2,2-dimethylpropyl)imidazo[1,2-a]pyridin-2-yl]amino]-N-hydroxyacetamide |
| SMILES | CC(C)(C)Cc1c(NCC(=O)NO)nc2c(N)cc(Br)cn12 |
| InChI | InChI=1S/C14H20BrN5O2/c1-14(2,3)5-10-12(17-6-11(21)19-22)18-13-9(16)4-8(15)7-20(10)13/h4,7,17,22H,5-6,16H2,1-3H3,(H,19,21) |
| InChIKey | AEMHKTHOLMKFQR-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 104.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.25 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|