About but-2-enyl octanoate
but-2-enyl octanoate (PubChem CID 141242223) has the molecular formula C12H22O2
and a molecular weight of 198.31 g/mol. Its IUPAC name is but-2-enyl octanoate.
Molecular Properties
| Compound Name | but-2-enyl octanoate |
| PubChem CID | 141242223 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | but-2-enyl octanoate |
| SMILES | CC=CCOC(=O)CCCCCCC |
| InChI | InChI=1S/C12H22O2/c1-3-5-7-8-9-10-12(13)14-11-6-4-2/h4,6H,3,5,7-11H2,1-2H3 |
| InChIKey | HRGPSGGNZRVDQP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze but-2-enyl octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-2-enyl octanoate?
The IUPAC name of but-2-enyl octanoate (CID 141242223) is but-2-enyl octanoate.
What is the SMILES notation for but-2-enyl octanoate?
The canonical SMILES for but-2-enyl octanoate is CC=CCOC(=O)CCCCCCC.
What is the InChIKey of but-2-enyl octanoate?
The InChIKey is HRGPSGGNZRVDQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O2/c1-3-5-7-8-9-10-12(13)14-11-6-4-2/h4,6H,3,5,7-11H2,1-2H3.
What are the key properties of but-2-enyl octanoate?
but-2-enyl octanoate has a molecular weight of 198.31 g/mol, XLogP of 3.47, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-enyl octanoate is sourced from PubChem (CID 141242223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).