C18H26F3N7 — CID 141242966
6-[(2S,5R)-2,5-dimethyl-4-(piperidin-3-ylmethyl)piperazin-1-yl]-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine (PubChem CID 141242966) has the molecular formula C18H26F3N7 and a molecular weight of 397.45 g/mol. Its IUPAC name is 6-[(2S,5R)-2,5-dimethyl-4-(piperidin-3-ylmethyl)piperazin-1-yl]-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine.
| Compound Name | 6-[(2S,5R)-2,5-dimethyl-4-(piperidin-3-ylmethyl)piperazin-1-yl]-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine |
|---|---|
| PubChem CID | 141242966 |
| Molecular Formula | C18H26F3N7 |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | 6-[(2S,5R)-2,5-dimethyl-4-(piperidin-3-ylmethyl)piperazin-1-yl]-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine |
| SMILES | C[C@@H]1CN(c2ccc3nnc(C(F)(F)F)n3n2)[C@@H](C)CN1CC1CCCNC1 |
| InChI | InChI=1S/C18H26F3N7/c1-12-10-27(13(2)9-26(12)11-14-4-3-7-22-8-14)16-6-5-15-23-24-17(18(19,20)21)28(15)25-16/h5-6,12-14,22H,3-4,7-11H2,1-2H3/t12-,13+,14?/m1/s1 |
| InChIKey | GHHLVLVVPBGEAG-AMIUJLCOSA-N |
| XLogP | 2.04 |
| TPSA | 61.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |