C9H4BrF9O4 — CID 141243315
(1,2,2,3,3,4,4,5,5-nonafluorocyclopentyl) 2-(2-bromoacetyl)oxyacetate (PubChem CID 141243315) has the molecular formula C9H4BrF9O4 and a molecular weight of 427.01 g/mol. Its IUPAC name is (1,2,2,3,3,4,4,5,5-nonafluorocyclopentyl) 2-(2-bromoacetyl)oxyacetate.
| Compound Name | (1,2,2,3,3,4,4,5,5-nonafluorocyclopentyl) 2-(2-bromoacetyl)oxyacetate |
|---|---|
| PubChem CID | 141243315 |
| Molecular Formula | C9H4BrF9O4 |
| Molecular Weight | 427.01 g/mol |
| Exact Mass | 425.91 |
| IUPAC Name | (1,2,2,3,3,4,4,5,5-nonafluorocyclopentyl) 2-(2-bromoacetyl)oxyacetate |
| SMILES | O=C(CBr)OCC(=O)OC1(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C9H4BrF9O4/c10-1-3(20)22-2-4(21)23-9(19)7(15,16)5(11,12)6(13,14)8(9,17)18/h1-2H2 |
| InChIKey | GONDRHXUOYUINO-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.01 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|