C16H14O3S — CID 141243409
7-hydroxy-3-(4-methoxyphenyl)-2,3-dihydrothiochromen-4-one (PubChem CID 141243409) has the molecular formula C16H14O3S and a molecular weight of 286.35 g/mol. Its IUPAC name is 7-hydroxy-3-(4-methoxyphenyl)-2,3-dihydrothiochromen-4-one.
| Compound Name | 7-hydroxy-3-(4-methoxyphenyl)-2,3-dihydrothiochromen-4-one |
|---|---|
| PubChem CID | 141243409 |
| Molecular Formula | C16H14O3S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 7-hydroxy-3-(4-methoxyphenyl)-2,3-dihydrothiochromen-4-one |
| SMILES | COc1ccc(C2CSc3cc(O)ccc3C2=O)cc1 |
| InChI | InChI=1S/C16H14O3S/c1-19-12-5-2-10(3-6-12)14-9-20-15-8-11(17)4-7-13(15)16(14)18/h2-8,14,17H,9H2,1H3 |
| InChIKey | NUACQPSTAVJORG-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |