C14H18O4 — CID 141244011
3-(2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)furan-2,5-dione (PubChem CID 141244011) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is 3-(2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)furan-2,5-dione.
| Compound Name | 3-(2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)furan-2,5-dione |
|---|---|
| PubChem CID | 141244011 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 3-(2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)furan-2,5-dione |
| SMILES | CC1(C)C2CCC1(C)C(O)(C1=CC(=O)OC1=O)C2 |
| InChI | InChI=1S/C14H18O4/c1-12(2)8-4-5-13(12,3)14(17,7-8)9-6-10(15)18-11(9)16/h6,8,17H,4-5,7H2,1-3H3 |
| InChIKey | VTPOEDDMWRKOBM-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|