About 8-bromo-2-[(2S)-2,5-dihydro-1H-pyrrol-2-yl]-[1]benzofuro[3,2-d]pyrimidine
8-bromo-2-[(2S)-2,5-dihydro-1H-pyrrol-2-yl]-[1]benzofuro[3,2-d]pyrimidine (PubChem CID 141244141) has the molecular formula C14H10BrN3O
and a molecular weight of 316.16 g/mol. Its IUPAC name is 8-bromo-2-[(2S)-2,5-dihydro-1H-pyrrol-2-yl]-[1]benzofuro[3,2-d]pyrimidine.
Molecular Properties
| Compound Name | 8-bromo-2-[(2S)-2,5-dihydro-1H-pyrrol-2-yl]-[1]benzofuro[3,2-d]pyrimidine |
| PubChem CID | 141244141 |
| Molecular Formula | C14H10BrN3O |
| Molecular Weight | 316.16 g/mol |
| Exact Mass | 315.00 |
| IUPAC Name | 8-bromo-2-[(2S)-2,5-dihydro-1H-pyrrol-2-yl]-[1]benzofuro[3,2-d]pyrimidine |
| SMILES | Brc1ccc2oc3cnc([C@@H]4C=CCN4)nc3c2c1 |
| InChI | InChI=1S/C14H10BrN3O/c15-8-3-4-11-9(6-8)13-12(19-11)7-17-14(18-13)10-2-1-5-16-10/h1-4,6-7,10,16H,5H2/t10-/m0/s1 |
| InChIKey | UIINALXNXGMFJC-JTQLQIEISA-N |
| XLogP | 3.34 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.16 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8-bromo-2-[(2S)-2,5-dihydro-1H-pyrrol-2-yl]-[1]benzofuro[3,2-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-2-[(2S)-2,5-dihydro-1H-pyrrol-2-yl]-[1]benzofuro[3,2-d]pyrimidine?
The IUPAC name of 8-bromo-2-[(2S)-2,5-dihydro-1H-pyrrol-2-yl]-[1]benzofuro[3,2-d]pyrimidine (CID 141244141) is 8-bromo-2-[(2S)-2,5-dihydro-1H-pyrrol-2-yl]-[1]benzofuro[3,2-d]pyrimidine.
What is the SMILES notation for 8-bromo-2-[(2S)-2,5-dihydro-1H-pyrrol-2-yl]-[1]benzofuro[3,2-d]pyrimidine?
The canonical SMILES for 8-bromo-2-[(2S)-2,5-dihydro-1H-pyrrol-2-yl]-[1]benzofuro[3,2-d]pyrimidine is Brc1ccc2oc3cnc([C@@H]4C=CCN4)nc3c2c1.
What is the InChIKey of 8-bromo-2-[(2S)-2,5-dihydro-1H-pyrrol-2-yl]-[1]benzofuro[3,2-d]pyrimidine?
The InChIKey is UIINALXNXGMFJC-JTQLQIEISA-N. The full InChI is InChI=1S/C14H10BrN3O/c15-8-3-4-11-9(6-8)13-12(19-11)7-17-14(18-13)10-2-1-5-16-10/h1-4,6-7,10,16H,5H2/t10-/m0/s1.
What are the key properties of 8-bromo-2-[(2S)-2,5-dihydro-1H-pyrrol-2-yl]-[1]benzofuro[3,2-d]pyrimidine?
8-bromo-2-[(2S)-2,5-dihydro-1H-pyrrol-2-yl]-[1]benzofuro[3,2-d]pyrimidine has a molecular weight of 316.16 g/mol, XLogP of 3.34, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-2-[(2S)-2,5-dihydro-1H-pyrrol-2-yl]-[1]benzofuro[3,2-d]pyrimidine is sourced from PubChem (CID 141244141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).