About 7-ethenoxy-4-methyloctane-2,5-diol
7-ethenoxy-4-methyloctane-2,5-diol (PubChem CID 141244384) has the molecular formula C11H22O3
and a molecular weight of 202.29 g/mol. Its IUPAC name is 7-ethenoxy-4-methyloctane-2,5-diol.
Molecular Properties
| Compound Name | 7-ethenoxy-4-methyloctane-2,5-diol |
| PubChem CID | 141244384 |
| Molecular Formula | C11H22O3 |
| Molecular Weight | 202.29 g/mol |
| Exact Mass | 202.16 |
| IUPAC Name | 7-ethenoxy-4-methyloctane-2,5-diol |
| SMILES | C=COC(C)CC(O)C(C)CC(C)O |
| InChI | InChI=1S/C11H22O3/c1-5-14-10(4)7-11(13)8(2)6-9(3)12/h5,8-13H,1,6-7H2,2-4H3 |
| InChIKey | RXPMHXUQVQAAHX-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.29 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 7-ethenoxy-4-methyloctane-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethenoxy-4-methyloctane-2,5-diol?
The IUPAC name of 7-ethenoxy-4-methyloctane-2,5-diol (CID 141244384) is 7-ethenoxy-4-methyloctane-2,5-diol.
What is the SMILES notation for 7-ethenoxy-4-methyloctane-2,5-diol?
The canonical SMILES for 7-ethenoxy-4-methyloctane-2,5-diol is C=COC(C)CC(O)C(C)CC(C)O.
What is the InChIKey of 7-ethenoxy-4-methyloctane-2,5-diol?
The InChIKey is RXPMHXUQVQAAHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O3/c1-5-14-10(4)7-11(13)8(2)6-9(3)12/h5,8-13H,1,6-7H2,2-4H3.
What are the key properties of 7-ethenoxy-4-methyloctane-2,5-diol?
7-ethenoxy-4-methyloctane-2,5-diol has a molecular weight of 202.29 g/mol, XLogP of 1.69, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethenoxy-4-methyloctane-2,5-diol is sourced from PubChem (CID 141244384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).