C31H32F3N3O2Si — CID 141244659
(3E)-3-[[3-[2-[4-(trifluoromethyl)phenyl]ethenyl]-1-(2-trimethylsilylethoxymethyl)indazol-6-yl]methylidene]-3a,4-dihydro-1H-indol-2-one (PubChem CID 141244659) has the molecular formula C31H32F3N3O2Si and a molecular weight of 563.70 g/mol. Its IUPAC name is (3E)-3-[[3-[2-[4-(trifluoromethyl)phenyl]ethenyl]-1-(2-trimethylsilylethoxymethyl)indazol-6-yl]methylidene]-3a,4-dihydro-1H-indol-2-one.
| Compound Name | (3E)-3-[[3-[2-[4-(trifluoromethyl)phenyl]ethenyl]-1-(2-trimethylsilylethoxymethyl)indazol-6-yl]methylidene]-3a,4-dihydro-1H-indol-2-one |
|---|---|
| PubChem CID | 141244659 |
| Molecular Formula | C31H32F3N3O2Si |
| Molecular Weight | 563.70 g/mol |
| Exact Mass | 563.22 |
| IUPAC Name | (3E)-3-[[3-[2-[4-(trifluoromethyl)phenyl]ethenyl]-1-(2-trimethylsilylethoxymethyl)indazol-6-yl]methylidene]-3a,4-dihydro-1H-indol-2-one |
| SMILES | C[Si](C)(C)CCOCn1nc(C=Cc2ccc(C(F)(F)F)cc2)c2ccc(/C=C3/C(=O)NC4=CC=CCC43)cc21 |
| InChI | InChI=1S/C31H32F3N3O2Si/c1-40(2,3)17-16-39-20-37-29-19-22(18-26-24-6-4-5-7-27(24)35-30(26)38)10-14-25(29)28(36-37)15-11-21-8-12-23(13-9-21)31(32,33)34/h4-5,7-15,18-19,24H,6,16-17,20H2,1-3H3,(H,35,38)/b15-11?,26-18+ |
| InChIKey | GNDRNPVPXPVOID-QTWFDPFMSA-N |
| XLogP | 7.51 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.70 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|