C19H17Cl2F3N2O — CID 141245169
1-[6-chloro-1-[4-(2-chloroethyl)phenyl]-5-(trifluoromethyl)benzimidazol-2-yl]propan-2-ol (PubChem CID 141245169) has the molecular formula C19H17Cl2F3N2O and a molecular weight of 417.26 g/mol. Its IUPAC name is 1-[6-chloro-1-[4-(2-chloroethyl)phenyl]-5-(trifluoromethyl)benzimidazol-2-yl]propan-2-ol.
| Compound Name | 1-[6-chloro-1-[4-(2-chloroethyl)phenyl]-5-(trifluoromethyl)benzimidazol-2-yl]propan-2-ol |
|---|---|
| PubChem CID | 141245169 |
| Molecular Formula | C19H17Cl2F3N2O |
| Molecular Weight | 417.26 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | 1-[6-chloro-1-[4-(2-chloroethyl)phenyl]-5-(trifluoromethyl)benzimidazol-2-yl]propan-2-ol |
| SMILES | CC(O)Cc1nc2cc(C(F)(F)F)c(Cl)cc2n1-c1ccc(CCCl)cc1 |
| InChI | InChI=1S/C19H17Cl2F3N2O/c1-11(27)8-18-25-16-9-14(19(22,23)24)15(21)10-17(16)26(18)13-4-2-12(3-5-13)6-7-20/h2-5,9-11,27H,6-8H2,1H3 |
| InChIKey | FKGZZZOOFCIQSV-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.26 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|