C11H14N2O2 — CID 141245355
2,2-dimethyl-N-(4-methyl-7-oxa-3-azabicyclo[4.1.0]hepta-1(6),2,4-trien-2-yl)propanamide (PubChem CID 141245355) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is 2,2-dimethyl-N-(4-methyl-7-oxa-3-azabicyclo[4.1.0]hepta-1(6),2,4-trien-2-yl)propanamide.
| Compound Name | 2,2-dimethyl-N-(4-methyl-7-oxa-3-azabicyclo[4.1.0]hepta-1(6),2,4-trien-2-yl)propanamide |
|---|---|
| PubChem CID | 141245355 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 2,2-dimethyl-N-(4-methyl-7-oxa-3-azabicyclo[4.1.0]hepta-1(6),2,4-trien-2-yl)propanamide |
| SMILES | Cc1cc2c(c(NC(=O)C(C)(C)C)n1)O2 |
| InChI | InChI=1S/C11H14N2O2/c1-6-5-7-8(15-7)9(12-6)13-10(14)11(2,3)4/h5H,1-4H3,(H,12,13,14) |
| InChIKey | UADOOANDGJUMKM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 54.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|