C4H5Cl3N6 — CID 141245550
2-N-(trichloromethyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 141245550) has the molecular formula C4H5Cl3N6 and a molecular weight of 243.48 g/mol. Its IUPAC name is 2-N-(trichloromethyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-(trichloromethyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 141245550 |
| Molecular Formula | C4H5Cl3N6 |
| Molecular Weight | 243.48 g/mol |
| Exact Mass | 241.96 |
| IUPAC Name | 2-N-(trichloromethyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | Nc1nc(N)nc(NC(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C4H5Cl3N6/c5-4(6,7)13-3-11-1(8)10-2(9)12-3/h(H5,8,9,10,11,12,13) |
| InChIKey | PHPVTFWOCQCNEG-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.48 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|