C26H19N3O6S — CID 141245692
[4-(furan-2-carbonyl)-3-(pyridine-4-carbonyl)-3-(thiophene-2-carbonyl)morpholin-2-yl]-pyridin-3-ylmethanone (PubChem CID 141245692) has the molecular formula C26H19N3O6S and a molecular weight of 501.52 g/mol. Its IUPAC name is [4-(furan-2-carbonyl)-3-(pyridine-4-carbonyl)-3-(thiophene-2-carbonyl)morpholin-2-yl]-pyridin-3-ylmethanone.
| Compound Name | [4-(furan-2-carbonyl)-3-(pyridine-4-carbonyl)-3-(thiophene-2-carbonyl)morpholin-2-yl]-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 141245692 |
| Molecular Formula | C26H19N3O6S |
| Molecular Weight | 501.52 g/mol |
| Exact Mass | 501.10 |
| IUPAC Name | [4-(furan-2-carbonyl)-3-(pyridine-4-carbonyl)-3-(thiophene-2-carbonyl)morpholin-2-yl]-pyridin-3-ylmethanone |
| SMILES | O=C(c1cccnc1)C1OCCN(C(=O)c2ccco2)C1(C(=O)c1ccncc1)C(=O)c1cccs1 |
| InChI | InChI=1S/C26H19N3O6S/c30-21(18-4-1-9-28-16-18)24-26(23(32)20-6-3-15-36-20,22(31)17-7-10-27-11-8-17)29(12-14-35-24)25(33)19-5-2-13-34-19/h1-11,13,15-16,24H,12,14H2 |
| InChIKey | PQDATQCYVYVABM-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 119.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.52 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|