C60H76O4P2 — CID 141246742
[4-[4-bis(5-tert-butyl-2,3-dimethylphenoxy)phosphanylphenyl]phenyl]-bis(5-tert-butyl-2,3-dimethylphenoxy)phosphane (PubChem CID 141246742) has the molecular formula C60H76O4P2 and a molecular weight of 923.21 g/mol. Its IUPAC name is [4-[4-bis(5-tert-butyl-2,3-dimethylphenoxy)phosphanylphenyl]phenyl]-bis(5-tert-butyl-2,3-dimethylphenoxy)phosphane.
| Compound Name | [4-[4-bis(5-tert-butyl-2,3-dimethylphenoxy)phosphanylphenyl]phenyl]-bis(5-tert-butyl-2,3-dimethylphenoxy)phosphane |
|---|---|
| PubChem CID | 141246742 |
| Molecular Formula | C60H76O4P2 |
| Molecular Weight | 923.21 g/mol |
| Exact Mass | 922.52 |
| IUPAC Name | [4-[4-bis(5-tert-butyl-2,3-dimethylphenoxy)phosphanylphenyl]phenyl]-bis(5-tert-butyl-2,3-dimethylphenoxy)phosphane |
| SMILES | Cc1cc(C(C)(C)C)cc(OP(Oc2cc(C(C)(C)C)cc(C)c2C)c2ccc(-c3ccc(P(Oc4cc(C(C)(C)C)cc(C)c4C)Oc4cc(C(C)(C)C)cc(C)c4C)cc3)cc2)c1C |
| InChI | InChI=1S/C60H76O4P2/c1-37-29-47(57(9,10)11)33-53(41(37)5)61-65(62-54-34-48(58(12,13)14)30-38(2)42(54)6)51-25-21-45(22-26-51)46-23-27-52(28-24-46)66(63-55-35-49(59(15,16)17)31-39(3)43(55)7)64-56-36-50(60(18,19)20)32-40(4)44(56)8/h21-36H,1-20H3 |
| InChIKey | ZLKMXVBEXHSSBL-UHFFFAOYSA-N |
| XLogP | 17.20 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 923.21 |
| LogP ≤ 5 | 17.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|