C21H42O4Si2 — CID 141246770
trans-(3R,4Z,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[1-[tert-butyl(dimethyl)silyl]oxypropylidene]-5-hydroxycyclohexan-1-one (PubChem CID 141246770) has the molecular formula C21H42O4Si2 and a molecular weight of 414.74 g/mol. Its IUPAC name is trans-(3R,4Z,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[1-[tert-butyl(dimethyl)silyl]oxypropylidene]-5-hydroxycyclohexan-1-one.
| Compound Name | trans-(3R,4Z,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[1-[tert-butyl(dimethyl)silyl]oxypropylidene]-5-hydroxycyclohexan-1-one |
|---|---|
| PubChem CID | 141246770 |
| Molecular Formula | C21H42O4Si2 |
| Molecular Weight | 414.74 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | trans-(3R,4Z,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[1-[tert-butyl(dimethyl)silyl]oxypropylidene]-5-hydroxycyclohexan-1-one |
| SMILES | CC/C(O[Si](C)(C)C(C)(C)C)=C1\[C@H](O)CC(=O)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H42O4Si2/c1-12-17(24-26(8,9)20(2,3)4)19-16(23)13-15(22)14-18(19)25-27(10,11)21(5,6)7/h16,18,23H,12-14H2,1-11H3/b19-17-/t16-,18-/m1/s1 |
| InChIKey | OMHMZVFPPMWXGT-TWRXYYHBSA-N |
| XLogP | 5.79 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.74 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|