C45H71N — CID 141248005
14-methyl-5,6,7,8,9,10,11,12,13-nona(propylidene)heptadeca-3,14-dien-4-amine (PubChem CID 141248005) has the molecular formula C45H71N and a molecular weight of 626.07 g/mol. Its IUPAC name is 14-methyl-5,6,7,8,9,10,11,12,13-nona(propylidene)heptadeca-3,14-dien-4-amine.
| Compound Name | 14-methyl-5,6,7,8,9,10,11,12,13-nona(propylidene)heptadeca-3,14-dien-4-amine |
|---|---|
| PubChem CID | 141248005 |
| Molecular Formula | C45H71N |
| Molecular Weight | 626.07 g/mol |
| Exact Mass | 625.56 |
| IUPAC Name | 14-methyl-5,6,7,8,9,10,11,12,13-nona(propylidene)heptadeca-3,14-dien-4-amine |
| SMILES | CCC=C(C)C(=CCC)C(=CCC)C(=CCC)C(=CCC)C(=CCC)C(=CCC)C(=CCC)C(=CCC)C(=CCC)C(N)=CCC |
| InChI | InChI=1S/C45H71N/c1-13-24-35(12)36(25-14-2)37(26-15-3)38(27-16-4)39(28-17-5)40(29-18-6)41(30-19-7)42(31-20-8)43(32-21-9)44(33-22-10)45(46)34-23-11/h24-34H,13-23,46H2,1-12H3 |
| InChIKey | XGNQLMLLKDXQFB-UHFFFAOYSA-N |
| XLogP | 14.62 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.07 |
| LogP ≤ 5 | 14.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|