C12H22Cl6O4Si — CID 141248315
[6,6-dichloro-3,3-bis(3,3-dichloropropyl)hexoxy]-trihydroxysilane (PubChem CID 141248315) has the molecular formula C12H22Cl6O4Si and a molecular weight of 471.11 g/mol. Its IUPAC name is [6,6-dichloro-3,3-bis(3,3-dichloropropyl)hexoxy]-trihydroxysilane.
| Compound Name | [6,6-dichloro-3,3-bis(3,3-dichloropropyl)hexoxy]-trihydroxysilane |
|---|---|
| PubChem CID | 141248315 |
| Molecular Formula | C12H22Cl6O4Si |
| Molecular Weight | 471.11 g/mol |
| Exact Mass | 467.94 |
| IUPAC Name | [6,6-dichloro-3,3-bis(3,3-dichloropropyl)hexoxy]-trihydroxysilane |
| SMILES | O[Si](O)(O)OCCC(CCC(Cl)Cl)(CCC(Cl)Cl)CCC(Cl)Cl |
| InChI | InChI=1S/C12H22Cl6O4Si/c13-9(14)1-4-12(5-2-10(15)16,6-3-11(17)18)7-8-22-23(19,20)21/h9-11,19-21H,1-8H2 |
| InChIKey | QMRPVDFWMDKVHU-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.11 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|