C18H21N3O3 — CID 141249024
[2-[[methyl-[(2-methylphenyl)carbamoyl]amino]methyl]phenyl] N-methylcarbamate (PubChem CID 141249024) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is [2-[[methyl-[(2-methylphenyl)carbamoyl]amino]methyl]phenyl] N-methylcarbamate.
| Compound Name | [2-[[methyl-[(2-methylphenyl)carbamoyl]amino]methyl]phenyl] N-methylcarbamate |
|---|---|
| PubChem CID | 141249024 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | [2-[[methyl-[(2-methylphenyl)carbamoyl]amino]methyl]phenyl] N-methylcarbamate |
| SMILES | CNC(=O)Oc1ccccc1CN(C)C(=O)Nc1ccccc1C |
| InChI | InChI=1S/C18H21N3O3/c1-13-8-4-6-10-15(13)20-17(22)21(3)12-14-9-5-7-11-16(14)24-18(23)19-2/h4-11H,12H2,1-3H3,(H,19,23)(H,20,22) |
| InChIKey | FHRCPPUWPPOWGF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |