C32H38F2N4O6 — CID 141249134
tert-butyl N-[(E)-3-(2,5-difluorophenyl)prop-2-enyl]-N-[(2R,3R,6R)-2-[2-(hydroxyamino)-2-oxoethyl]-6-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]oxan-3-yl]carbamate (PubChem CID 141249134) has the molecular formula C32H38F2N4O6 and a molecular weight of 612.67 g/mol. Its IUPAC name is tert-butyl N-[(E)-3-(2,5-difluorophenyl)prop-2-enyl]-N-[(2R,3R,6R)-2-[2-(hydroxyamino)-2-oxoethyl]-6-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]oxan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(E)-3-(2,5-difluorophenyl)prop-2-enyl]-N-[(2R,3R,6R)-2-[2-(hydroxyamino)-2-oxoethyl]-6-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]oxan-3-yl]carbamate |
|---|---|
| PubChem CID | 141249134 |
| Molecular Formula | C32H38F2N4O6 |
| Molecular Weight | 612.67 g/mol |
| Exact Mass | 612.28 |
| IUPAC Name | tert-butyl N-[(E)-3-(2,5-difluorophenyl)prop-2-enyl]-N-[(2R,3R,6R)-2-[2-(hydroxyamino)-2-oxoethyl]-6-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]oxan-3-yl]carbamate |
| SMILES | COc1ccc2nccc(CC[C@@H]3CC[C@@H](N(C/C=C/c4cc(F)ccc4F)C(=O)OC(C)(C)C)[C@@H](CC(=O)NO)O3)c2n1 |
| InChI | InChI=1S/C32H38F2N4O6/c1-32(2,3)44-31(40)38(17-5-6-21-18-22(33)8-11-24(21)34)26-13-10-23(43-27(26)19-28(39)37-41)9-7-20-15-16-35-25-12-14-29(42-4)36-30(20)25/h5-6,8,11-12,14-16,18,23,26-27,41H,7,9-10,13,17,19H2,1-4H3,(H,37,39)/b6-5+/t23-,26-,27-/m1/s1 |
| InChIKey | FKKIYHVKHVNFLA-CDEZIDNCSA-N |
| XLogP | 5.61 |
| TPSA | 123.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.67 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|