About 3-phenylpropylbenzene
3-phenylpropylbenzene (PubChem CID 14125) has the molecular formula C15H16
and a molecular weight of 196.29 g/mol. Its IUPAC name is 3-phenylpropylbenzene.
Molecular Properties
| Compound Name | 3-phenylpropylbenzene |
| PubChem CID | 14125 |
| Molecular Formula | C15H16 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 3-phenylpropylbenzene |
| SMILES | c1ccc(CCCc2ccccc2)cc1 |
| InChI | InChI=1S/C15H16/c1-3-8-14(9-4-1)12-7-13-15-10-5-2-6-11-15/h1-6,8-11H,7,12-13H2 |
| InChIKey | VEAFKIYNHVBNIP-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-phenylpropylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylpropylbenzene?
The IUPAC name of 3-phenylpropylbenzene (CID 14125) is 3-phenylpropylbenzene.
What is the SMILES notation for 3-phenylpropylbenzene?
The canonical SMILES for 3-phenylpropylbenzene is c1ccc(CCCc2ccccc2)cc1.
What is the InChIKey of 3-phenylpropylbenzene?
The InChIKey is VEAFKIYNHVBNIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16/c1-3-8-14(9-4-1)12-7-13-15-10-5-2-6-11-15/h1-6,8-11H,7,12-13H2.
What are the key properties of 3-phenylpropylbenzene?
3-phenylpropylbenzene has a molecular weight of 196.29 g/mol, XLogP of 3.86, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylpropylbenzene is sourced from PubChem (CID 14125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).