About 1-benzyltriazole
1-benzyltriazole (PubChem CID 141250243) has the molecular formula C18H18N6
and a molecular weight of 318.38 g/mol. Its IUPAC name is 1-benzyltriazole.
Molecular Properties
| Compound Name | 1-benzyltriazole |
| PubChem CID | 141250243 |
| Molecular Formula | C18H18N6 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 1-benzyltriazole |
| SMILES | c1ccc(Cn2ccnn2)cc1.c1ccc(Cn2ccnn2)cc1 |
| InChI | InChI=1S/2C9H9N3/c2*1-2-4-9(5-3-1)8-12-7-6-10-11-12/h2*1-7H,8H2 |
| InChIKey | UPLBEFYAKWAGGR-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-benzyltriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyltriazole?
The IUPAC name of 1-benzyltriazole (CID 141250243) is 1-benzyltriazole.
What is the SMILES notation for 1-benzyltriazole?
The canonical SMILES for 1-benzyltriazole is c1ccc(Cn2ccnn2)cc1.c1ccc(Cn2ccnn2)cc1.
What is the InChIKey of 1-benzyltriazole?
The InChIKey is UPLBEFYAKWAGGR-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H9N3/c2*1-2-4-9(5-3-1)8-12-7-6-10-11-12/h2*1-7H,8H2.
What are the key properties of 1-benzyltriazole?
1-benzyltriazole has a molecular weight of 318.38 g/mol, XLogP of 2.65, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyltriazole is sourced from PubChem (CID 141250243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).