C38H73NO9S — CID 141250281
2,2-bis[[(Z)-hexadec-9-enoyl]oxy]ethyl-(2-hydroxyethyl)-methylazanium;methyl sulfate (PubChem CID 141250281) has the molecular formula C38H73NO9S and a molecular weight of 720.07 g/mol. Its IUPAC name is 2,2-bis[[(Z)-hexadec-9-enoyl]oxy]ethyl-(2-hydroxyethyl)-methylazanium;methyl sulfate.
| Compound Name | 2,2-bis[[(Z)-hexadec-9-enoyl]oxy]ethyl-(2-hydroxyethyl)-methylazanium;methyl sulfate |
|---|---|
| PubChem CID | 141250281 |
| Molecular Formula | C38H73NO9S |
| Molecular Weight | 720.07 g/mol |
| Exact Mass | 719.50 |
| IUPAC Name | 2,2-bis[[(Z)-hexadec-9-enoyl]oxy]ethyl-(2-hydroxyethyl)-methylazanium;methyl sulfate |
| SMILES | CCCCCC/C=C\CCCCCCCC(=O)OC(C[NH+](C)CCO)OC(=O)CCCCCCC/C=C\CCCCCC.COS(=O)(=O)[O-] |
| InChI | InChI=1S/C37H69NO5.CH4O4S/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-35(40)42-37(34-38(3)32-33-39)43-36(41)31-29-27-25-23-21-19-17-15-13-11-9-7-5-2;1-5-6(2,3)4/h14-17,37,39H,4-13,18-34H2,1-3H3;1H3,(H,2,3,4)/b16-14-,17-15-; |
| InChIKey | WYZUAXKCXVLLDW-MGTLNPTPSA-N |
| XLogP | 7.51 |
| TPSA | 143.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.07 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|