C42H82N8 — CID 141250354
2-N,4-N-dibutyl-2-N,4-N-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-1-N-(1,3,5-triazin-2-yl)undecane-1,2,4-triamine (PubChem CID 141250354) has the molecular formula C42H82N8 and a molecular weight of 699.17 g/mol. Its IUPAC name is 2-N,4-N-dibutyl-2-N,4-N-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-1-N-(1,3,5-triazin-2-yl)undecane-1,2,4-triamine.
| Compound Name | 2-N,4-N-dibutyl-2-N,4-N-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-1-N-(1,3,5-triazin-2-yl)undecane-1,2,4-triamine |
|---|---|
| PubChem CID | 141250354 |
| Molecular Formula | C42H82N8 |
| Molecular Weight | 699.17 g/mol |
| Exact Mass | 698.67 |
| IUPAC Name | 2-N,4-N-dibutyl-2-N,4-N-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-1-N-(1,3,5-triazin-2-yl)undecane-1,2,4-triamine |
| SMILES | CCCCCCCC(CC(CNc1ncncn1)N(CCCC)C1CC(C)(C)N(C)C(C)(C)C1)N(CCCC)C1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C42H82N8/c1-14-17-20-21-22-23-34(49(24-18-15-2)36-27-39(4,5)47(12)40(6,7)28-36)26-35(31-44-38-45-32-43-33-46-38)50(25-19-16-3)37-29-41(8,9)48(13)42(10,11)30-37/h32-37H,14-31H2,1-13H3,(H,43,44,45,46) |
| InChIKey | VOCLWOPIRWUTAO-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 63.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.17 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|