C14H12ClIN4O2S — CID 141251042
7-benzylsulfonyl-2-chloro-5-iodo-N-methylpyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 141251042) has the molecular formula C14H12ClIN4O2S and a molecular weight of 462.70 g/mol. Its IUPAC name is 7-benzylsulfonyl-2-chloro-5-iodo-N-methylpyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 7-benzylsulfonyl-2-chloro-5-iodo-N-methylpyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 141251042 |
| Molecular Formula | C14H12ClIN4O2S |
| Molecular Weight | 462.70 g/mol |
| Exact Mass | 461.94 |
| IUPAC Name | 7-benzylsulfonyl-2-chloro-5-iodo-N-methylpyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CNc1nc(Cl)nc2c1c(I)cn2S(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C14H12ClIN4O2S/c1-17-12-11-10(16)7-20(13(11)19-14(15)18-12)23(21,22)8-9-5-3-2-4-6-9/h2-7H,8H2,1H3,(H,17,18,19) |
| InChIKey | DRKRRLQJMWNKGR-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.70 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|