About [(E)-ethylideneamino] N-[3-[[(E)-ethylideneamino]oxycarbonyl-sulfanylamino]phenyl]-N-sulfanylcarbamate
[(E)-ethylideneamino] N-[3-[[(E)-ethylideneamino]oxycarbonyl-sulfanylamino]phenyl]-N-sulfanylcarbamate (PubChem CID 141252071) has the molecular formula C12H14N4O4S2
and a molecular weight of 342.40 g/mol. Its IUPAC name is [(E)-ethylideneamino] N-[3-[[(E)-ethylideneamino]oxycarbonyl-sulfanylamino]phenyl]-N-sulfanylcarbamate.
Molecular Properties
| Compound Name | [(E)-ethylideneamino] N-[3-[[(E)-ethylideneamino]oxycarbonyl-sulfanylamino]phenyl]-N-sulfanylcarbamate |
| PubChem CID | 141252071 |
| Molecular Formula | C12H14N4O4S2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | [(E)-ethylideneamino] N-[3-[[(E)-ethylideneamino]oxycarbonyl-sulfanylamino]phenyl]-N-sulfanylcarbamate |
| SMILES | C/C=N/OC(=O)N(S)c1cccc(N(S)C(=O)O/N=C/C)c1 |
| InChI | InChI=1S/C12H14N4O4S2/c1-3-13-19-11(17)15(21)9-6-5-7-10(8-9)16(22)12(18)20-14-4-2/h3-8,21-22H,1-2H3/b13-3+,14-4+ |
| InChIKey | RPNIUMCRLJXXAJ-NPJRDEIVSA-N |
| XLogP | 3.27 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [(E)-ethylideneamino] N-[3-[[(E)-ethylideneamino]oxycarbonyl-sulfanylamino]phenyl]-N-sulfanylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-ethylideneamino] N-[3-[[(E)-ethylideneamino]oxycarbonyl-sulfanylamino]phenyl]-N-sulfanylcarbamate?
The IUPAC name of [(E)-ethylideneamino] N-[3-[[(E)-ethylideneamino]oxycarbonyl-sulfanylamino]phenyl]-N-sulfanylcarbamate (CID 141252071) is [(E)-ethylideneamino] N-[3-[[(E)-ethylideneamino]oxycarbonyl-sulfanylamino]phenyl]-N-sulfanylcarbamate.
What is the SMILES notation for [(E)-ethylideneamino] N-[3-[[(E)-ethylideneamino]oxycarbonyl-sulfanylamino]phenyl]-N-sulfanylcarbamate?
The canonical SMILES for [(E)-ethylideneamino] N-[3-[[(E)-ethylideneamino]oxycarbonyl-sulfanylamino]phenyl]-N-sulfanylcarbamate is C/C=N/OC(=O)N(S)c1cccc(N(S)C(=O)O/N=C/C)c1.
What is the InChIKey of [(E)-ethylideneamino] N-[3-[[(E)-ethylideneamino]oxycarbonyl-sulfanylamino]phenyl]-N-sulfanylcarbamate?
The InChIKey is RPNIUMCRLJXXAJ-NPJRDEIVSA-N. The full InChI is InChI=1S/C12H14N4O4S2/c1-3-13-19-11(17)15(21)9-6-5-7-10(8-9)16(22)12(18)20-14-4-2/h3-8,21-22H,1-2H3/b13-3+,14-4+.
What are the key properties of [(E)-ethylideneamino] N-[3-[[(E)-ethylideneamino]oxycarbonyl-sulfanylamino]phenyl]-N-sulfanylcarbamate?
[(E)-ethylideneamino] N-[3-[[(E)-ethylideneamino]oxycarbonyl-sulfanylamino]phenyl]-N-sulfanylcarbamate has a molecular weight of 342.40 g/mol, XLogP of 3.27, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-ethylideneamino] N-[3-[[(E)-ethylideneamino]oxycarbonyl-sulfanylamino]phenyl]-N-sulfanylcarbamate is sourced from PubChem (CID 141252071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).