C25H19ClN4 — CID 141252966
4-[2-[(3-chlorophenyl)methyl]-5-(6-methyl-2-pyridinyl)-1H-imidazol-4-yl]quinoline (PubChem CID 141252966) has the molecular formula C25H19ClN4 and a molecular weight of 410.91 g/mol. Its IUPAC name is 4-[2-[(3-chlorophenyl)methyl]-5-(6-methyl-2-pyridinyl)-1H-imidazol-4-yl]quinoline.
| Compound Name | 4-[2-[(3-chlorophenyl)methyl]-5-(6-methyl-2-pyridinyl)-1H-imidazol-4-yl]quinoline |
|---|---|
| PubChem CID | 141252966 |
| Molecular Formula | C25H19ClN4 |
| Molecular Weight | 410.91 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 4-[2-[(3-chlorophenyl)methyl]-5-(6-methyl-2-pyridinyl)-1H-imidazol-4-yl]quinoline |
| SMILES | Cc1cccc(-c2[nH]c(Cc3cccc(Cl)c3)nc2-c2ccnc3ccccc23)n1 |
| InChI | InChI=1S/C25H19ClN4/c1-16-6-4-11-22(28-16)25-24(20-12-13-27-21-10-3-2-9-19(20)21)29-23(30-25)15-17-7-5-8-18(26)14-17/h2-14H,15H2,1H3,(H,29,30) |
| InChIKey | KLNXDASXSOHLAJ-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.91 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |