C28H27NO3 — CID 141253575
(3Z)-5-[4-(4-ethylphenoxy)phenyl]-3-[(4-propan-2-yloxyphenyl)methylidene]-1H-pyrrol-2-one (PubChem CID 141253575) has the molecular formula C28H27NO3 and a molecular weight of 425.53 g/mol. Its IUPAC name is (3Z)-5-[4-(4-ethylphenoxy)phenyl]-3-[(4-propan-2-yloxyphenyl)methylidene]-1H-pyrrol-2-one.
| Compound Name | (3Z)-5-[4-(4-ethylphenoxy)phenyl]-3-[(4-propan-2-yloxyphenyl)methylidene]-1H-pyrrol-2-one |
|---|---|
| PubChem CID | 141253575 |
| Molecular Formula | C28H27NO3 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | (3Z)-5-[4-(4-ethylphenoxy)phenyl]-3-[(4-propan-2-yloxyphenyl)methylidene]-1H-pyrrol-2-one |
| SMILES | CCc1ccc(Oc2ccc(C3=C/C(=C/c4ccc(OC(C)C)cc4)C(=O)N3)cc2)cc1 |
| InChI | InChI=1S/C28H27NO3/c1-4-20-5-11-25(12-6-20)32-26-15-9-22(10-16-26)27-18-23(28(30)29-27)17-21-7-13-24(14-8-21)31-19(2)3/h5-19H,4H2,1-3H3,(H,29,30)/b23-17- |
| InChIKey | RDKKOCNXHGKTBH-QJOMJCCJSA-N |
| XLogP | 6.38 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|