C27H30O7 — CID 141253649
[1,5-bis(4-methoxyphenyl)-2,4-dimethyl-3-oxo-4-prop-2-enoyloxypentan-2-yl] prop-2-enoate (PubChem CID 141253649) has the molecular formula C27H30O7 and a molecular weight of 466.53 g/mol. Its IUPAC name is [1,5-bis(4-methoxyphenyl)-2,4-dimethyl-3-oxo-4-prop-2-enoyloxypentan-2-yl] prop-2-enoate.
| Compound Name | [1,5-bis(4-methoxyphenyl)-2,4-dimethyl-3-oxo-4-prop-2-enoyloxypentan-2-yl] prop-2-enoate |
|---|---|
| PubChem CID | 141253649 |
| Molecular Formula | C27H30O7 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | [1,5-bis(4-methoxyphenyl)-2,4-dimethyl-3-oxo-4-prop-2-enoyloxypentan-2-yl] prop-2-enoate |
| SMILES | C=CC(=O)OC(C)(Cc1ccc(OC)cc1)C(=O)C(C)(Cc1ccc(OC)cc1)OC(=O)C=C |
| InChI | InChI=1S/C27H30O7/c1-7-23(28)33-26(3,17-19-9-13-21(31-5)14-10-19)25(30)27(4,34-24(29)8-2)18-20-11-15-22(32-6)16-12-20/h7-16H,1-2,17-18H2,3-6H3 |
| InChIKey | PIVBMCHZUKJWGO-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|