C45H60N22O3 — CID 141253943
bis[2-[3-[6-(2-aminopyrimidin-5-yl)-2-morpholin-4-ylpurin-9-yl]pyrrolidin-1-yl]-4-methylpiperazin-1-yl]methanone (PubChem CID 141253943) has the molecular formula C45H60N22O3 and a molecular weight of 957.13 g/mol. Its IUPAC name is bis[2-[3-[6-(2-aminopyrimidin-5-yl)-2-morpholin-4-ylpurin-9-yl]pyrrolidin-1-yl]-4-methylpiperazin-1-yl]methanone.
| Compound Name | bis[2-[3-[6-(2-aminopyrimidin-5-yl)-2-morpholin-4-ylpurin-9-yl]pyrrolidin-1-yl]-4-methylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 141253943 |
| Molecular Formula | C45H60N22O3 |
| Molecular Weight | 957.13 g/mol |
| Exact Mass | 956.52 |
| IUPAC Name | bis[2-[3-[6-(2-aminopyrimidin-5-yl)-2-morpholin-4-ylpurin-9-yl]pyrrolidin-1-yl]-4-methylpiperazin-1-yl]methanone |
| SMILES | CN1CCN(C(=O)N2CCN(C)CC2N2CCC(n3cnc4c(-c5cnc(N)nc5)nc(N5CCOCC5)nc43)C2)C(N2CCC(n3cnc4c(-c5cnc(N)nc5)nc(N5CCOCC5)nc43)C2)C1 |
| InChI | InChI=1S/C45H60N22O3/c1-58-7-9-64(33(25-58)62-5-3-31(23-62)66-27-52-37-35(29-19-48-41(46)49-20-29)54-43(56-39(37)66)60-11-15-69-16-12-60)45(68)65-10-8-59(2)26-34(65)63-6-4-32(24-63)67-28-53-38-36(30-21-50-42(47)51-22-30)55-44(57-40(38)67)61-13-17-70-18-14-61/h19-22,27-28,31-34H,3-18,23-26H2,1-2H3,(H2,46,48,49)(H2,47,50,51) |
| InChIKey | MWTLCMJQVFNHAR-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 252.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 23 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 957.13 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 23 |