C22H42O4 — CID 141253960
dipropan-2-yl 2,2-di(propan-2-yl)decanedioate (PubChem CID 141253960) has the molecular formula C22H42O4 and a molecular weight of 370.57 g/mol. Its IUPAC name is dipropan-2-yl 2,2-di(propan-2-yl)decanedioate.
| Compound Name | dipropan-2-yl 2,2-di(propan-2-yl)decanedioate |
|---|---|
| PubChem CID | 141253960 |
| Molecular Formula | C22H42O4 |
| Molecular Weight | 370.57 g/mol |
| Exact Mass | 370.31 |
| IUPAC Name | dipropan-2-yl 2,2-di(propan-2-yl)decanedioate |
| SMILES | CC(C)OC(=O)CCCCCCCC(C(=O)OC(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H42O4/c1-16(2)22(17(3)4,21(24)26-19(7)8)15-13-11-9-10-12-14-20(23)25-18(5)6/h16-19H,9-15H2,1-8H3 |
| InChIKey | VRSXXSBHGXFYSJ-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.57 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|