C28H24FN3O2 — CID 141254427
ethyl 5-(1-benzylindol-3-yl)-1-[(4-fluorophenyl)methyl]pyrazole-3-carboxylate (PubChem CID 141254427) has the molecular formula C28H24FN3O2 and a molecular weight of 453.52 g/mol. Its IUPAC name is ethyl 5-(1-benzylindol-3-yl)-1-[(4-fluorophenyl)methyl]pyrazole-3-carboxylate.
| Compound Name | ethyl 5-(1-benzylindol-3-yl)-1-[(4-fluorophenyl)methyl]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 141254427 |
| Molecular Formula | C28H24FN3O2 |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | ethyl 5-(1-benzylindol-3-yl)-1-[(4-fluorophenyl)methyl]pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2cn(Cc3ccccc3)c3ccccc23)n(Cc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C28H24FN3O2/c1-2-34-28(33)25-16-27(32(30-25)18-21-12-14-22(29)15-13-21)24-19-31(17-20-8-4-3-5-9-20)26-11-7-6-10-23(24)26/h3-16,19H,2,17-18H2,1H3 |
| InChIKey | RNCIUWWDVRSIJT-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 49.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |